CAS 2994-71-0 appears in our catalog under these names: Perfluoro-1,2-dimethylcyclobutane, 95%, Perfluoro-1,2-dimethylcyclobutane, 97%, remainder 1,3-isomer, 1,1,2,2,3,4-Hexafluoro-3,4-Bis(Trifluoromethyl)-Cyclobutane, Perfluoro-1,2-dimethylcyclobutane, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 10g.
1,1,2,2,3,4-hexafluoro-3,4-bis(trifluoromethyl)cyclobutane (CAS 2994-71-0) is a chemical compound with the molecular formula C6F12 and a molecular weight of 300.04 g/mol. IUPAC name: 1,1,2,2,3,4-hexafluoro-3,4-bis(trifluoromethyl)cyclobutane. InChIKey: RBTROQHBNLSUTL-UHFFFAOYSA-N.
| Molecular formula | C6F12 |
|---|---|
| Molecular weight | 300.04 g/mol |
| IUPAC name | 1,1,2,2,3,4-hexafluoro-3,4-bis(trifluoromethyl)cyclobutane |
| InChIKey | RBTROQHBNLSUTL-UHFFFAOYSA-N |
| SMILES | C1(C(C(C1(F)F)(F)F)(C(F)(F)F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)