CAS 1805123-70-9 is the registry number for 4,5-Dibromo-2-(trifluoromethoxy)aniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
4,5-dibromo-2-(trifluoromethoxy)aniline (CAS 1805123-70-9) is a chemical compound with the molecular formula C7H4Br2F3NO and a molecular weight of 334.92 g/mol. IUPAC name: 4,5-dibromo-2-(trifluoromethoxy)aniline. InChIKey: UAEDUKCOOBBCRX-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2F3NO |
|---|---|
| Molecular weight | 334.92 g/mol |
| IUPAC name | 4,5-dibromo-2-(trifluoromethoxy)aniline |
| InChIKey | UAEDUKCOOBBCRX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)OC(F)(F)F)N |
Computed by PubChem (NCBI)