CAS 1806329-10-1 is the registry number for 2,4-Dibromo-5-(trifluoromethoxy)aniline, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,4-dibromo-5-(trifluoromethoxy)aniline (CAS 1806329-10-1) is a chemical compound with the molecular formula C7H4Br2F3NO and a molecular weight of 334.92 g/mol. IUPAC name: 2,4-dibromo-5-(trifluoromethoxy)aniline. InChIKey: WXFMYXSHIMFVSR-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2F3NO |
|---|---|
| Molecular weight | 334.92 g/mol |
| IUPAC name | 2,4-dibromo-5-(trifluoromethoxy)aniline |
| InChIKey | WXFMYXSHIMFVSR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1OC(F)(F)F)Br)Br)N |
Computed by PubChem (NCBI)