Products 886499-87-2
CAS 886499-87-2 is the registry number for 2,4-Dibromo-6-(trifluoromethoxy)aniline, 99%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 25g.
2,4-dibromo-6-(trifluoromethoxy)aniline (CAS 886499-87-2) is a chemical compound with the molecular formula C7H4Br2F3NO and a molecular weight of 334.92 g/mol. IUPAC name: 2,4-dibromo-6-(trifluoromethoxy)aniline. InChIKey: KJEAYONMSVJIRV-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2F3NO |
|---|---|
| Molecular weight | 334.92 g/mol |
| IUPAC name | 2,4-dibromo-6-(trifluoromethoxy)aniline |
| InChIKey | KJEAYONMSVJIRV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1OC(F)(F)F)N)Br)Br |
Computed by PubChem (NCBI)