Products 1805137-37-4
CAS 1805137-37-4 is the registry number for 3-Bromo-2-chloro-4-(difluoromethoxy)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
3-bromo-2-chloro-4-(difluoromethoxy)pyridine (CAS 1805137-37-4) is a chemical compound with the molecular formula C6H3BrClF2NO and a molecular weight of 258.45 g/mol. IUPAC name: 3-bromo-2-chloro-4-(difluoromethoxy)pyridine. InChIKey: IGPNMARLFKSZIS-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClF2NO |
|---|---|
| Molecular weight | 258.45 g/mol |
| IUPAC name | 3-bromo-2-chloro-4-(difluoromethoxy)pyridine |
| InChIKey | IGPNMARLFKSZIS-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1OC(F)F)Br)Cl |
Computed by PubChem (NCBI)