Products 1806058-06-9
CAS 1806058-06-9 appears in our catalog under these names: 3-Bromo-6-chloro-2-(difluoromethoxy)pyridine, 95%, 3–Bromo–6–chloro–2–(difluoromethoxy)pyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
3-bromo-6-chloro-2-(difluoromethoxy)pyridine (CAS 1806058-06-9) is a chemical compound with the molecular formula C6H3BrClF2NO and a molecular weight of 258.45 g/mol. IUPAC name: 3-bromo-6-chloro-2-(difluoromethoxy)pyridine. InChIKey: ULICTZZBVBIALT-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClF2NO |
|---|---|
| Molecular weight | 258.45 g/mol |
| IUPAC name | 3-bromo-6-chloro-2-(difluoromethoxy)pyridine |
| InChIKey | ULICTZZBVBIALT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)OC(F)F)Cl |
Computed by PubChem (NCBI)