Products 2940956-51-2
CAS 2940956-51-2 is the registry number for 4-[bromo(difluoro)methoxy]-2-chloro-pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
4-[bromo(difluoro)methoxy]-2-chloropyridine (CAS 2940956-51-2) is a chemical compound with the molecular formula C6H3BrClF2NO and a molecular weight of 258.45 g/mol. IUPAC name: 4-[bromo(difluoro)methoxy]-2-chloropyridine. InChIKey: BOXQPWKNJBXETP-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClF2NO |
|---|---|
| Molecular weight | 258.45 g/mol |
| IUPAC name | 4-[bromo(difluoro)methoxy]-2-chloropyridine |
| InChIKey | BOXQPWKNJBXETP-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1OC(F)(F)Br)Cl |
Computed by PubChem (NCBI)