Products 1805314-46-8
CAS 1805314-46-8 is the registry number for 6-(Difluoromethyl)-3-nitropyridin-2(1H)-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-(difluoromethyl)-3-nitro-1H-pyridin-2-one (CAS 1805314-46-8) is a chemical compound with the molecular formula C6H4F2N2O3 and a molecular weight of 190.10 g/mol. IUPAC name: 6-(difluoromethyl)-3-nitro-1H-pyridin-2-one. InChIKey: JQZBZXQEZXMFOG-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O3 |
|---|---|
| Molecular weight | 190.10 g/mol |
| IUPAC name | 6-(difluoromethyl)-3-nitro-1H-pyridin-2-one |
| InChIKey | JQZBZXQEZXMFOG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1)C(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)