Products 1805459-23-7

CAS 1805459-23-7 is the registry number for 2-Cyano-3-fluoro-4-pyridinecarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-cyano-3-fluoropyridine-4-carboxylic acid (CAS 1805459-23-7) is a chemical compound with the molecular formula C7H3FN2O2 and a molecular weight of 166.11 g/mol. IUPAC name: 2-cyano-3-fluoropyridine-4-carboxylic acid. InChIKey: AFFGDGAVPXKRRV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3FN2O2
Molecular weight166.11 g/mol
IUPAC name2-cyano-3-fluoropyridine-4-carboxylic acid
InChIKeyAFFGDGAVPXKRRV-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1C(=O)O)F)C#N

Computed by PubChem (NCBI)