Products 1805560-37-5
CAS 1805560-37-5 is the registry number for Ethyl 6-amino-3-cyanopicolinate, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
Ethyl 6-amino-3-cyanopyridine-2-carboxylate (CAS 1805560-37-5) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: ethyl 6-amino-3-cyanopyridine-2-carboxylate. InChIKey: WXSMRGVPMLBHPN-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | ethyl 6-amino-3-cyanopyridine-2-carboxylate |
| InChIKey | WXSMRGVPMLBHPN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=N1)N)C#N |
Computed by PubChem (NCBI)