CAS 180569-27-1 appears in our catalog under these names: 6-Chlorobenzimidazole-4-carboxylic acid, 95%, 6–Chloro–1H–benzo(d)imidazole–4–carboxylic acid, 6-Chloro-1H-benzo[d]imidazole-4-carboxylic acid, 95%, 95%, 6-CHLORO-1H-BENZO[D]IMIDAZOLE-4-CARBOXYLIC ACID, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
6-chloro-1H-benzimidazole-4-carboxylic acid (CAS 180569-27-1) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 6-chloro-1H-benzimidazole-4-carboxylic acid. InChIKey: PLUIBRICHWAFJL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 6-chloro-1H-benzimidazole-4-carboxylic acid |
| InChIKey | PLUIBRICHWAFJL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1C(=O)O)N=CN2)Cl |
Computed by PubChem (NCBI)