Products 1805790-44-6
CAS 1805790-44-6 is the registry number for O1-tert-butyl O4-ethyl (3R,4S)-3-hydroxypiperidine-1,4-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 5g.
1-O-tert-butyl 4-O-ethyl (3R,4S)-3-hydroxypiperidine-1,4-dicarboxylate (CAS 1805790-44-6) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl (3R,4S)-3-hydroxypiperidine-1,4-dicarboxylate. InChIKey: AKHBRSJRXLGZJK-UWVGGRQHSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl (3R,4S)-3-hydroxypiperidine-1,4-dicarboxylate |
| InChIKey | AKHBRSJRXLGZJK-UWVGGRQHSA-N |
| SMILES | CCOC(=O)[C@H]1CCN(C[C@@H]1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)