CAS 217488-49-8 appears in our catalog under these names: 1-tert-Butyl 4-ethyl 3-hydroxypiperidine-1,4-dicarboxylate, 95%, 1-tert-Butyl 4-ethyl 3-hydroxypiperidine-1,4-dicarboxylate 95%, 1-tert-Butyl 4-ethyl 3-hydroxypiperidine-1,4-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
1-O-tert-butyl 4-O-ethyl 3-hydroxypiperidine-1,4-dicarboxylate (CAS 217488-49-8) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 3-hydroxypiperidine-1,4-dicarboxylate. InChIKey: AKHBRSJRXLGZJK-UHFFFAOYSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 3-hydroxypiperidine-1,4-dicarboxylate |
| InChIKey | AKHBRSJRXLGZJK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)