CAS 180624-24-2 appears in our catalog under these names: 7-Methoxy-1h-indole-5-carboxylic acid methyl ester, 95%, Methyl 7-Methoxyindole-5-carboxylate 95%, 1H-Indole-5-carboxylic acid, 7-methoxy-, methyl ester, 95%, 95%, METHYL 7-METHOXYINDOLE-5-CARBOXYLATE, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
Methyl 7-methoxy-1H-indole-5-carboxylate (CAS 180624-24-2) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: methyl 7-methoxy-1H-indole-5-carboxylate. InChIKey: MLHFMFQDMLBLID-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | methyl 7-methoxy-1H-indole-5-carboxylate |
| InChIKey | MLHFMFQDMLBLID-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)C(=O)OC)C=CN2 |
Computed by PubChem (NCBI)