CAS 1806576-73-7 appears in our catalog under these names: 1-(4-Amino-3-nitrophenyl)propan-2-one, 95%, 1–(4–Amino–3–nitrophenyl)propan–2–one. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
1-(4-amino-3-nitrophenyl)propan-2-one (CAS 1806576-73-7) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 1-(4-amino-3-nitrophenyl)propan-2-one. InChIKey: PQFCDXMSPNONRZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 1-(4-amino-3-nitrophenyl)propan-2-one |
| InChIKey | PQFCDXMSPNONRZ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)