CAS 18069-79-9 appears in our catalog under these names: Estradiol Valerate EP Impurity F (17-Butyrate Estradiol), Estradiol Valerate Impurity 6 (Estradiol Valerate EP Impurity F), 3-Hydroxyestra-1,3,5(10)-trien-17beta-yl Butanoate (Estradiol Butyrate), Estradiol 17-butyrate, Estradiol impurity 5. Offered by: Chemat Brand, Hubei YoungXin, Mikromol, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, Get quote.
[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] butanoate (CAS 18069-79-9) is a chemical compound with the molecular formula C22H30O3 and a molecular weight of 342.5 g/mol. IUPAC name: [(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] butanoate. InChIKey: XRKFWLKYSYKIKT-KOVVAJLHSA-N.
| Molecular formula | C22H30O3 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | [(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] butanoate |
| InChIKey | XRKFWLKYSYKIKT-KOVVAJLHSA-N |
| SMILES | CCCC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C3C=CC(=C4)O)C |
Computed by PubChem (NCBI)