CAS 20248-18-4 is the registry number for Progesterone Impurity 54. Offered by: Chemat Brand. Available pack sizes: on request.
3-oxo-23,24-bisnorchola-1,4-dien-22-oic acid is a steroid acid that is 23,24-bisnor-chol-1,4-dien-22-oic acid bearing an additional oxo substituent at position 3. It is a steroid acid and a 3-oxo-Delta(1),Delta(4)-steroid. It is a conjugate acid of a 3-oxo-23,24-bisnorchola-1,4-dien-22-oate(1-). It derives from a hydride of a pregnane.
Source: ChEBI
| Molecular formula | C22H30O3 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | (2S)-2-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]propanoic acid |
| InChIKey | OZESBBVMFLIODA-WAMTXRNCSA-N |
| SMILES | C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)C=C[C@]34C)C)C(=O)O |
Computed by PubChem (NCBI)