CAS 25862-97-9 appears in our catalog under these names: Testosterone Impurity 7, Testosterone Propionate Impurity 5(Testosterone Propionate EP Impurity E), Testosterone Propionate EP Impurity E. Offered by: Chemat Brand, Hubei YoungXin, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate (CAS 25862-97-9) is a chemical compound with the molecular formula C22H30O3 and a molecular weight of 342.5 g/mol. IUPAC name: [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate. InChIKey: UDBOJNPOZOKLHR-BLQWBTBKSA-N.
| Molecular formula | C22H30O3 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| InChIKey | UDBOJNPOZOKLHR-BLQWBTBKSA-N |
| SMILES | CCC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C=CC4=CC(=O)CC[C@]34C)C |
Computed by PubChem (NCBI)