Products 1807196-29-7
CAS 1807196-29-7 is the registry number for 1-Bromo-5-(difluoromethoxy)-2-fluoro-4-nitrobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-bromo-5-(difluoromethoxy)-2-fluoro-4-nitrobenzene (CAS 1807196-29-7) is a chemical compound with the molecular formula C7H3BrF3NO3 and a molecular weight of 286.00 g/mol. IUPAC name: 1-bromo-5-(difluoromethoxy)-2-fluoro-4-nitrobenzene. InChIKey: AIURQKKLRDOFRT-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO3 |
|---|---|
| Molecular weight | 286.00 g/mol |
| IUPAC name | 1-bromo-5-(difluoromethoxy)-2-fluoro-4-nitrobenzene |
| InChIKey | AIURQKKLRDOFRT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)OC(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)