Products 1807260-74-7
CAS 1807260-74-7 is the registry number for Ethyl 6-bromo-5-hydroxypicolinate, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 6-bromo-5-hydroxypyridine-2-carboxylate (CAS 1807260-74-7) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: ethyl 6-bromo-5-hydroxypyridine-2-carboxylate. InChIKey: XKJSXERPOVBOFF-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | ethyl 6-bromo-5-hydroxypyridine-2-carboxylate |
| InChIKey | XKJSXERPOVBOFF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(C=C1)O)Br |
Computed by PubChem (NCBI)