Products 1807534-81-1
CAS 1807534-81-1 is the registry number for 2-(2-Aminoethyl)-6-chloroisoindolin-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.
2-(2-aminoethyl)-6-chloro-3H-isoindol-1-one (CAS 1807534-81-1) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 2-(2-aminoethyl)-6-chloro-3H-isoindol-1-one. InChIKey: LZNPSTZCEVNVEF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 2-(2-aminoethyl)-6-chloro-3H-isoindol-1-one |
| InChIKey | LZNPSTZCEVNVEF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)Cl)C(=O)N1CCN |
Computed by PubChem (NCBI)