CAS 1807792-33-1 is the registry number for Methyl (S)-3-(6-bromo-3,4-dihydro-2H-benzo[b][1,4]oxazin-2-yl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanoate (CAS 1807792-33-1) is a chemical compound with the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. IUPAC name: methyl 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanoate. InChIKey: DAKAGPJNVZKQHA-VIFPVBQESA-N.
| Molecular formula | C12H14BrNO3 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | methyl 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanoate |
| InChIKey | DAKAGPJNVZKQHA-VIFPVBQESA-N |
| SMILES | COC(=O)CC[C@H]1CNC2=C(O1)C=CC(=C2)Br |
Computed by PubChem (NCBI)