CAS 1807885-09-1 appears in our catalog under these names: 2-{5-((2R)-oxolan-2-yl)-1,3,4-oxadiazol-2-yl}piperidine hydrochloride, 98%, 2-{5-((2R)-Oxolan-2-yl)-1,3,4-oxadiazol-2-yl}piperidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[(2R)-oxolan-2-yl]-5-piperidin-2-yl-1,3,4-oxadiazole;hydrochloride (CAS 1807885-09-1) is a chemical compound with the molecular formula C11H18ClN3O2 and a molecular weight of 259.73 g/mol. IUPAC name: 2-[(2R)-oxolan-2-yl]-5-piperidin-2-yl-1,3,4-oxadiazole;hydrochloride. InChIKey: KLMLIZCGYJZTDZ-ICLMXVQUSA-N.
| Molecular formula | C11H18ClN3O2 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 2-[(2R)-oxolan-2-yl]-5-piperidin-2-yl-1,3,4-oxadiazole;hydrochloride |
| InChIKey | KLMLIZCGYJZTDZ-ICLMXVQUSA-N |
| SMILES | C1CCNC(C1)C2=NN=C(O2)[C@H]3CCCO3.Cl |
Computed by PubChem (NCBI)