CAS 1955564-56-3 is the registry number for 4-(2-(Dimethylamino)ethoxy)-N'-hydroxybenzene-1-carboximidamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[2-(dimethylamino)ethoxy]-N'-hydroxybenzenecarboximidamide;hydrochloride (CAS 1955564-56-3) is a chemical compound with the molecular formula C11H18ClN3O2 and a molecular weight of 259.73 g/mol. IUPAC name: 4-[2-(dimethylamino)ethoxy]-N'-hydroxybenzenecarboximidamide;hydrochloride. InChIKey: SGHDATGDBFJXAU-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN3O2 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 4-[2-(dimethylamino)ethoxy]-N'-hydroxybenzenecarboximidamide;hydrochloride |
| InChIKey | SGHDATGDBFJXAU-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC1=CC=C(C=C1)/C(=N/O)/N.Cl |
Computed by PubChem (NCBI)