CAS 2177264-13-8 is the registry number for (6-Amino-pyridin-3-ylmethyl)-carbamic acid tert-butyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(6-amino-3-pyridinyl)methyl]carbamate;hydrochloride (CAS 2177264-13-8) is a chemical compound with the molecular formula C11H18ClN3O2 and a molecular weight of 259.73 g/mol. IUPAC name: tert-butyl N-[(6-amino-3-pyridinyl)methyl]carbamate;hydrochloride. InChIKey: RGYSRENCHAPPBZ-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN3O2 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | tert-butyl N-[(6-amino-3-pyridinyl)methyl]carbamate;hydrochloride |
| InChIKey | RGYSRENCHAPPBZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CN=C(C=C1)N.Cl |
Computed by PubChem (NCBI)