Products 2177264-13-8

CAS 2177264-13-8 is the registry number for (6-Amino-pyridin-3-ylmethyl)-carbamic acid tert-butyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(6-amino-3-pyridinyl)methyl]carbamate;hydrochloride (CAS 2177264-13-8) is a chemical compound with the molecular formula C11H18ClN3O2 and a molecular weight of 259.73 g/mol. IUPAC name: tert-butyl N-[(6-amino-3-pyridinyl)methyl]carbamate;hydrochloride. InChIKey: RGYSRENCHAPPBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18ClN3O2
Molecular weight259.73 g/mol
IUPAC nametert-butyl N-[(6-amino-3-pyridinyl)methyl]carbamate;hydrochloride
InChIKeyRGYSRENCHAPPBZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC1=CN=C(C=C1)N.Cl

Computed by PubChem (NCBI)