CAS 1807920-07-5 appears in our catalog under these names: Rac-(2R,3R)-2-(1-ethyl-1H-imidazol-2-yl)oxolane-3-carboxylic acid, 95%, rac-(2R,3R)-2-(1-Ethyl-1H-imidazol-2-yl)oxolane-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2R,3R)-2-(1-ethylimidazol-2-yl)oxolane-3-carboxylic acid (CAS 1807920-07-5) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: (2R,3R)-2-(1-ethylimidazol-2-yl)oxolane-3-carboxylic acid. InChIKey: QHIONVJPPYSNSK-HTQZYQBOSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | (2R,3R)-2-(1-ethylimidazol-2-yl)oxolane-3-carboxylic acid |
| InChIKey | QHIONVJPPYSNSK-HTQZYQBOSA-N |
| SMILES | CCN1C=CN=C1[C@H]2[C@@H](CCO2)C(=O)O |
Computed by PubChem (NCBI)