Products 1807921-03-4

CAS 1807921-03-4 appears in our catalog under these names: 2-Fluoro-2-phenylethene-1-sulfonyl chloride, 95%, (Z)-2-Fluoro-2-phenylethene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

(Z)-2-fluoro-2-phenylethenesulfonyl chloride (CAS 1807921-03-4) is a chemical compound with the molecular formula C8H6ClFO2S and a molecular weight of 220.65 g/mol. IUPAC name: (Z)-2-fluoro-2-phenylethenesulfonyl chloride. InChIKey: CGPXKURCIDYBMB-VURMDHGXSA-N.

Identity
Molecular formulaC8H6ClFO2S
Molecular weight220.65 g/mol
IUPAC name(Z)-2-fluoro-2-phenylethenesulfonyl chloride
InChIKeyCGPXKURCIDYBMB-VURMDHGXSA-N
SMILESC1=CC=C(C=C1)/C(=C/S(=O)(=O)Cl)/F

Computed by PubChem (NCBI)