Products 315495-38-6
CAS 315495-38-6 is the registry number for (E)-2-(4-Fluorophenyl)ethene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(E)-2-(4-fluorophenyl)ethenesulfonyl chloride (CAS 315495-38-6) is a chemical compound with the molecular formula C8H6ClFO2S and a molecular weight of 220.65 g/mol. IUPAC name: (E)-2-(4-fluorophenyl)ethenesulfonyl chloride. InChIKey: WEYVXKRBZKSRRM-AATRIKPKSA-N.
| Molecular formula | C8H6ClFO2S |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | (E)-2-(4-fluorophenyl)ethenesulfonyl chloride |
| InChIKey | WEYVXKRBZKSRRM-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)
Synonyms:
(E)-2-(4-fluorophenyl)ethene-1-sulfonyl chloride, 2-(4-fluorophenyl)ethene-1-sulfonyl chloride, (E)-2-(4-fluorophenyl)ethenesulfonyl chloride, WEYVXKRBZKSRRM-AATRIKPKSA-N, (E)-4-fluorostyrylsulfonyl chloride, 2-(4-fluorophenyl)ethene-1-sulfonylchloride, (E)-2-(4-fluorophenyl)vinylsulfonyl chloride