Products 1822768-21-7
CAS 1822768-21-7 is the registry number for 2-Chloro-6-fluoro-3-(methylthio)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-chloro-6-fluoro-3-methylsulfanylbenzoic acid (CAS 1822768-21-7) is a chemical compound with the molecular formula C8H6ClFO2S and a molecular weight of 220.65 g/mol. IUPAC name: 2-chloro-6-fluoro-3-methylsulfanylbenzoic acid. InChIKey: LUBSKESYOKDRCO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2S |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | 2-chloro-6-fluoro-3-methylsulfanylbenzoic acid |
| InChIKey | LUBSKESYOKDRCO-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)F)C(=O)O)Cl |
Computed by PubChem (NCBI)