CAS 1807933-94-3 is the registry number for (S)-1-(5-Bromothiophen-2-yl)ethan-1-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 1g, 5g.
(1S)-1-(5-bromothiophen-2-yl)ethanamine;hydrochloride (CAS 1807933-94-3) is a chemical compound with the molecular formula C6H9BrClNS and a molecular weight of 242.57 g/mol. IUPAC name: (1S)-1-(5-bromothiophen-2-yl)ethanamine;hydrochloride. InChIKey: ZGWRLJDOXYAZRI-WCCKRBBISA-N.
| Molecular formula | C6H9BrClNS |
|---|---|
| Molecular weight | 242.57 g/mol |
| IUPAC name | (1S)-1-(5-bromothiophen-2-yl)ethanamine;hydrochloride |
| InChIKey | ZGWRLJDOXYAZRI-WCCKRBBISA-N |
| SMILES | C[C@@H](C1=CC=C(S1)Br)N.Cl |
Computed by PubChem (NCBI)