CAS 2343963-75-5 appears in our catalog under these names: (R)–1–(4–Bromothiophen–2–yl)ethan–1–amine hydrochloride, (R)-1-(4-Bromothiophen-2-yl)ethan-1-amine hydrochloride, 98%, 98%, (1r)-1-(4-Bromothiophen-2-yl)ethan-1-amine hydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R)-1-(4-bromothiophen-2-yl)ethanamine;hydrochloride (CAS 2343963-75-5) is a chemical compound with the molecular formula C6H9BrClNS and a molecular weight of 242.57 g/mol. IUPAC name: (1R)-1-(4-bromothiophen-2-yl)ethanamine;hydrochloride. InChIKey: FDYVFPGCSXCBRM-PGMHMLKASA-N.
| Molecular formula | C6H9BrClNS |
|---|---|
| Molecular weight | 242.57 g/mol |
| IUPAC name | (1R)-1-(4-bromothiophen-2-yl)ethanamine;hydrochloride |
| InChIKey | FDYVFPGCSXCBRM-PGMHMLKASA-N |
| SMILES | C[C@H](C1=CC(=CS1)Br)N.Cl |
Computed by PubChem (NCBI)