CAS 2418596-90-2 appears in our catalog under these names: (R)-1-(5-Bromothiophen-3-yl)ethanamine hydrochloride, 95%, 95%, (R)-1-(5-Bromothiophen-3-yl)ethanamine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
(1R)-1-(5-bromothiophen-3-yl)ethanamine;hydrochloride (CAS 2418596-90-2) is a chemical compound with the molecular formula C6H9BrClNS and a molecular weight of 242.57 g/mol. IUPAC name: (1R)-1-(5-bromothiophen-3-yl)ethanamine;hydrochloride. InChIKey: XPCQYVDLAWUTKI-PGMHMLKASA-N.
| Molecular formula | C6H9BrClNS |
|---|---|
| Molecular weight | 242.57 g/mol |
| IUPAC name | (1R)-1-(5-bromothiophen-3-yl)ethanamine;hydrochloride |
| InChIKey | XPCQYVDLAWUTKI-PGMHMLKASA-N |
| SMILES | C[C@H](C1=CSC(=C1)Br)N.Cl |
Computed by PubChem (NCBI)