CAS 1807937-74-1 is the registry number for (1S,3S,5S)-2-Azabicyclo(3.1.0)hexane-3-carboxylic acid hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(1S,3S,5S)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid;hydrochloride (CAS 1807937-74-1) is a chemical compound with the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. IUPAC name: (1S,3S,5S)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid;hydrochloride. InChIKey: SQFNKGNUVXRNFR-SHLRHQAISA-N.
| Molecular formula | C6H10ClNO2 |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | (1S,3S,5S)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid;hydrochloride |
| InChIKey | SQFNKGNUVXRNFR-SHLRHQAISA-N |
| SMILES | C1[C@@H]2[C@H]1N[C@@H](C2)C(=O)O.Cl |
Computed by PubChem (NCBI)