Products 1807938-26-6
CAS 1807938-26-6 is the registry number for rac-(3aR,7aR)-2-Benzyl-octahydro-1H-isoindole-3a-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3aS,7aS)-2-benzyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid (CAS 1807938-26-6) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 259.34 g/mol. IUPAC name: (3aS,7aS)-2-benzyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid. InChIKey: CZQSVBQTEURCPD-GDBMZVCRSA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | (3aS,7aS)-2-benzyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
| InChIKey | CZQSVBQTEURCPD-GDBMZVCRSA-N |
| SMILES | C1CC[C@]2(CN(C[C@H]2C1)CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)