CAS 1807939-14-5 appears in our catalog under these names: ((2R,5R)-5-Phenyltetrahydrofuran-2-yl)methanamine hydrochloride, 98%, ((2R,5R)-5-Phenyloxolan-2-yl)methanamine hydrochloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
[(2R,5R)-5-phenyloxolan-2-yl]methanamine;hydrochloride (CAS 1807939-14-5) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: [(2R,5R)-5-phenyloxolan-2-yl]methanamine;hydrochloride. InChIKey: COUXSMCIXWFXJQ-NDXYWBNTSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | [(2R,5R)-5-phenyloxolan-2-yl]methanamine;hydrochloride |
| InChIKey | COUXSMCIXWFXJQ-NDXYWBNTSA-N |
| SMILES | C1C[C@@H](O[C@H]1CN)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)