CAS 1808640-98-3 is the registry number for ((2R,5S)-5-Phenyltetrahydrofuran-2-yl)methanamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,5S)-5-phenyloxolan-2-yl]methanamine;hydrochloride (CAS 1808640-98-3) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: [(2R,5S)-5-phenyloxolan-2-yl]methanamine;hydrochloride. InChIKey: COUXSMCIXWFXJQ-DHXVBOOMSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | [(2R,5S)-5-phenyloxolan-2-yl]methanamine;hydrochloride |
| InChIKey | COUXSMCIXWFXJQ-DHXVBOOMSA-N |
| SMILES | C1C[C@H](O[C@H]1CN)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)