CAS 1807939-44-1 is the registry number for rac-(1R,2S)-2-(4-(Propan-2-yl)phenyl)cyclohexan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Trans-(1R,2S)-2-(4-propan-2-ylphenyl)cyclohexan-1-ol (CAS 1807939-44-1) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: trans-(1R,2S)-2-(4-propan-2-ylphenyl)cyclohexan-1-ol. InChIKey: DWSGOQPKPDSNPU-LSDHHAIUSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-propan-2-ylphenyl)cyclohexan-1-ol |
| InChIKey | DWSGOQPKPDSNPU-LSDHHAIUSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)[C@@H]2CCCC[C@H]2O |
Computed by PubChem (NCBI)