Products 1807940-42-6
CAS 1807940-42-6 is the registry number for (1R)-2-Amino-1-(3-bromophenyl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R)-2-amino-1-(3-bromophenyl)ethanol;hydrochloride (CAS 1807940-42-6) is a chemical compound with the molecular formula C8H11BrClNO and a molecular weight of 252.53 g/mol. IUPAC name: (1R)-2-amino-1-(3-bromophenyl)ethanol;hydrochloride. InChIKey: ITDCEEMCJJUSBB-QRPNPIFTSA-N.
| Molecular formula | C8H11BrClNO |
|---|---|
| Molecular weight | 252.53 g/mol |
| IUPAC name | (1R)-2-amino-1-(3-bromophenyl)ethanol;hydrochloride |
| InChIKey | ITDCEEMCJJUSBB-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@H](CN)O.Cl |
Computed by PubChem (NCBI)