CAS 1807941-38-3 appears in our catalog under these names: Rac-(4aR,9aR)-6-bromo-2,3,4,4a,9,9a-hexahydro-1H-carbazole hydrochloride, 95%, rac-(4aR,9aR)-6-Bromo-2,3,4,4a,9,9a-hexahydro-1H-carbazole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(4aR,9aR)-6-bromo-2,3,4,4a,9,9a-hexahydro-1H-carbazole;hydrochloride (CAS 1807941-38-3) is a chemical compound with the molecular formula C12H15BrClN and a molecular weight of 288.61 g/mol. IUPAC name: (4aR,9aR)-6-bromo-2,3,4,4a,9,9a-hexahydro-1H-carbazole;hydrochloride. InChIKey: QVBDJZKQOLOBPZ-FOKYBFFNSA-N.
| Molecular formula | C12H15BrClN |
|---|---|
| Molecular weight | 288.61 g/mol |
| IUPAC name | (4aR,9aR)-6-bromo-2,3,4,4a,9,9a-hexahydro-1H-carbazole;hydrochloride |
| InChIKey | QVBDJZKQOLOBPZ-FOKYBFFNSA-N |
| SMILES | C1CC[C@@H]2[C@H](C1)C3=C(N2)C=CC(=C3)Br.Cl |
Computed by PubChem (NCBI)