CAS 2845126-29-4 is the registry number for 1-Benzyl-5-bromo-1,2,3,6-tetrahydropyridine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-benzyl-5-bromo-3,6-dihydro-2H-pyridine;hydrochloride (CAS 2845126-29-4) is a chemical compound with the molecular formula C12H15BrClN and a molecular weight of 288.61 g/mol. IUPAC name: 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine;hydrochloride. InChIKey: CQUWPRJNFPBPEJ-UHFFFAOYSA-N.
| Molecular formula | C12H15BrClN |
|---|---|
| Molecular weight | 288.61 g/mol |
| IUPAC name | 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine;hydrochloride |
| InChIKey | CQUWPRJNFPBPEJ-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=C1)Br)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)