Products 75077-70-2
CAS 75077-70-2 is the registry number for 9-Bromo-1,2,3,5,6,7-hexahydropyrido[3,2,1-ij]quinoline hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene;hydrochloride (CAS 75077-70-2) is a chemical compound with the molecular formula C12H15BrClN and a molecular weight of 288.61 g/mol. IUPAC name: 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene;hydrochloride. InChIKey: FHUCJFNRJCKNEP-UHFFFAOYSA-N.
| Molecular formula | C12H15BrClN |
|---|---|
| Molecular weight | 288.61 g/mol |
| IUPAC name | 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene;hydrochloride |
| InChIKey | FHUCJFNRJCKNEP-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=CC3=C2N(C1)CCC3)Br.Cl |
Computed by PubChem (NCBI)