CAS 1807941-73-6 appears in our catalog under these names: (1S)–1–(5–Chloropyridin–2–yl)ethan–1–amine dihydrochloride, (1S)-1-(5-Chloropyridin-2-yl)ethan-1-amine dihydrochloride, (1S)-1-(5-Chloropyridin-2-yl)ethan-1-amine dihydrochloride, 95%, 95%, (1S)-1-(5-Chloropyridin-2-yl)ethan-1-amine dihydrochloride, 98%, (1S)-1-(5-Chloropyridin-2-yl)ethan-1-amine dihydrochloride, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 0,5g, 50mg, 250mg, 1g.
(1S)-1-(5-chloro-2-pyridinyl)ethanamine;dihydrochloride (CAS 1807941-73-6) is a chemical compound with the molecular formula C7H11Cl3N2 and a molecular weight of 229.5 g/mol. IUPAC name: (1S)-1-(5-chloro-2-pyridinyl)ethanamine;dihydrochloride. InChIKey: ZMXJVLOGPBMATF-XRIGFGBMSA-N.
| Molecular formula | C7H11Cl3N2 |
|---|---|
| Molecular weight | 229.5 g/mol |
| IUPAC name | (1S)-1-(5-chloro-2-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | ZMXJVLOGPBMATF-XRIGFGBMSA-N |
| SMILES | C[C@@H](C1=NC=C(C=C1)Cl)N.Cl.Cl |
Computed by PubChem (NCBI)