Products 1808212-34-1
CAS 1808212-34-1 is the registry number for 3',5'-Dichloro-2'-fluoro-[1,1'-biphenyl]-4-carbaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(3,5-dichloro-2-fluorophenyl)benzaldehyde (CAS 1808212-34-1) is a chemical compound with the molecular formula C13H7Cl2FO and a molecular weight of 269.09 g/mol. IUPAC name: 4-(3,5-dichloro-2-fluorophenyl)benzaldehyde. InChIKey: MDJUBZKSKARRJZ-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2FO |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 4-(3,5-dichloro-2-fluorophenyl)benzaldehyde |
| InChIKey | MDJUBZKSKARRJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=C(C(=CC(=C2)Cl)Cl)F |
Computed by PubChem (NCBI)