Products 3002492-49-8
CAS 3002492-49-8 is the registry number for (2,3-dichloro-6-fluorophenyl)(phenyl)methanone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,3-dichloro-6-fluorophenyl)-phenylmethanone (CAS 3002492-49-8) is a chemical compound with the molecular formula C13H7Cl2FO and a molecular weight of 269.09 g/mol. IUPAC name: (2,3-dichloro-6-fluorophenyl)-phenylmethanone. InChIKey: NXMUUWNZCZOWJO-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2FO |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | (2,3-dichloro-6-fluorophenyl)-phenylmethanone |
| InChIKey | NXMUUWNZCZOWJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2Cl)Cl)F |
Computed by PubChem (NCBI)