CAS 65214-59-7 appears in our catalog under these names: 2,4-Dichloro-4'-fluorobenzophenone, 95%, (2,4-Dichlorophenyl)(4-fluorophenyl)methanone, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(2,4-dichlorophenyl)-(4-fluorophenyl)methanone (CAS 65214-59-7) is a chemical compound with the molecular formula C13H7Cl2FO and a molecular weight of 269.09 g/mol. IUPAC name: (2,4-dichlorophenyl)-(4-fluorophenyl)methanone. InChIKey: UVAKGOJIHCGXID-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2FO |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | (2,4-dichlorophenyl)-(4-fluorophenyl)methanone |
| InChIKey | UVAKGOJIHCGXID-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2)Cl)Cl)F |
Computed by PubChem (NCBI)