Products 1808580-34-8
CAS 1808580-34-8 is the registry number for 2-Amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylic acid;hydrochloride (CAS 1808580-34-8) is a chemical compound with the molecular formula C8H11ClN2O2S and a molecular weight of 234.70 g/mol. IUPAC name: 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylic acid;hydrochloride. InChIKey: UUWRGZQLLPSDGW-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylic acid;hydrochloride |
| InChIKey | UUWRGZQLLPSDGW-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)SC(=N2)N)C(=O)O.Cl |
Computed by PubChem (NCBI)