CAS 18087-10-0 appears in our catalog under these names: 4,5-Dimethyl-2-nitrophenol, 95%, 4,5-Dimethyl-2-nitrophenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
4,5-dimethyl-2-nitrophenol (CAS 18087-10-0) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 4,5-dimethyl-2-nitrophenol. InChIKey: KGDIYDUZVHFMHQ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 4,5-dimethyl-2-nitrophenol |
| InChIKey | KGDIYDUZVHFMHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)