CAS 1809143-85-8 is the registry number for Methyl 11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxylate 5,5-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylate (CAS 1809143-85-8) is a chemical compound with the molecular formula C15H11NO5S and a molecular weight of 317.3 g/mol. IUPAC name: methyl 6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylate. InChIKey: UWMHPOWJLGZWKU-UHFFFAOYSA-N.
| Molecular formula | C15H11NO5S |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | methyl 6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylate |
| InChIKey | UWMHPOWJLGZWKU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)S(=O)(=O)C3=CC=CC=C3C(=O)N2 |
Computed by PubChem (NCBI)