CAS 747411-00-3 is the registry number for 2-[4-(Methylthio)-3-nitrobenzoyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(4-methylsulfanyl-3-nitrobenzoyl)benzoic acid (CAS 747411-00-3) is a chemical compound with the molecular formula C15H11NO5S and a molecular weight of 317.3 g/mol. IUPAC name: 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoic acid. InChIKey: CHERYECRDOGVEN-UHFFFAOYSA-N.
| Molecular formula | C15H11NO5S |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoic acid |
| InChIKey | CHERYECRDOGVEN-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)