Products 747411-00-3

CAS 747411-00-3 is the registry number for 2-[4-(Methylthio)-3-nitrobenzoyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-methylsulfanyl-3-nitrobenzoyl)benzoic acid (CAS 747411-00-3) is a chemical compound with the molecular formula C15H11NO5S and a molecular weight of 317.3 g/mol. IUPAC name: 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoic acid. InChIKey: CHERYECRDOGVEN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11NO5S
Molecular weight317.3 g/mol
IUPAC name2-(4-methylsulfanyl-3-nitrobenzoyl)benzoic acid
InChIKeyCHERYECRDOGVEN-UHFFFAOYSA-N
SMILESCSC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)