Products 694473-93-3

CAS 694473-93-3 is the registry number for 4-((1,1,3-Trioxo-2,3-dihydro-1,2-benzothiazol-2-yl)methyl)benzoic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.

Structural formula: {0} (CAS {1})

4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzoic acid (CAS 694473-93-3) is a chemical compound with the molecular formula C15H11NO5S and a molecular weight of 317.3 g/mol. IUPAC name: 4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzoic acid. InChIKey: SZXYUCMJXHGNGH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11NO5S
Molecular weight317.3 g/mol
IUPAC name4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzoic acid
InChIKeySZXYUCMJXHGNGH-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(S2(=O)=O)CC3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)