CAS 694473-93-3 is the registry number for 4-((1,1,3-Trioxo-2,3-dihydro-1,2-benzothiazol-2-yl)methyl)benzoic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.
4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzoic acid (CAS 694473-93-3) is a chemical compound with the molecular formula C15H11NO5S and a molecular weight of 317.3 g/mol. IUPAC name: 4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzoic acid. InChIKey: SZXYUCMJXHGNGH-UHFFFAOYSA-N.
| Molecular formula | C15H11NO5S |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzoic acid |
| InChIKey | SZXYUCMJXHGNGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)CC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)